#!/usr/bin/env python3
"""
Test script for MolMIM molecular interpolation functionality
"""
import json
import base64
import os
import sys
import requests
import numpy as np
from rdkit import Chem
from rdkit.Chem import Draw
import matplotlib.pyplot as plt
from PIL import Image
import io
# Add the current directory to the Python path
sys.path.insert(0, os.path.dirname(os.path.abspath(__file__)))
# MolMIM server configuration
MOLMIM_BASE_URL = os.getenv("MOLMIM_BASE_URL", "http://localhost:8000")
def test_molecular_interpolation():
"""Test the molecular interpolation functionality"""
# Test molecules (caffeine and aspirin)
smiles1 = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" # Caffeine
smiles2 = "CC(=O)OC1=CC=CC=C1C(=O)O" # Aspirin
print(f"Testing molecular interpolation between:")
print(f" Molecule 1: {smiles1} (Caffeine)")
print(f" Molecule 2: {smiles2} (Aspirin)")
print()
try:
# Step 1: Canonicalize SMILES strings
smiles1_canon = Chem.CanonSmiles(smiles1)
smiles2_canon = Chem.CanonSmiles(smiles2)
print(f"Canonicalized SMILES:")
print(f" Molecule 1: {smiles1_canon}")
print(f" Molecule 2: {smiles2_canon}")
print()
# Step 2: Get hidden states for both molecules
print("Step 1: Getting hidden states...")
url = f"{MOLMIM_BASE_URL}/hidden"
data = {"sequences": [smiles1_canon, smiles2_canon]}
response = requests.post(url, json=data, headers={"Content-Type": "application/json"})
response.raise_for_status()
hiddens_response = response.json()
hiddens = hiddens_response["hiddens"]
print(f"✓ Retrieved hidden states for {len(hiddens)} molecules")
# Step 3: Convert to numpy array and extract the two hidden state vectors
hiddens_array = np.array(hiddens)
hiddens_array = np.squeeze(hiddens_array)
row1 = hiddens_array[0] # First molecule
row2 = hiddens_array[1] # Second molecule
print(f"✓ Hidden state shapes: {row1.shape}, {row2.shape}")
# Step 4: Generate interpolated hidden states
print("Step 2: Generating interpolated hidden states...")
num_interpolations = 10 # Reduced for testing
interpolated_rows = []
for i in range(num_interpolations):
t = i / (num_interpolations - 1)
interpolated_row = (1 - t) * row1 + t * row2
interpolated_rows.append(interpolated_row)
# Convert interpolated vectors to array format expected by decoder
interpolated_hiddens = np.expand_dims(np.array(interpolated_rows), axis=1)
print(f"✓ Generated {num_interpolations} interpolated hidden states")
# Step 5: Decode interpolated hidden states to SMILES
print("Step 3: Decoding interpolated hidden states to SMILES...")
url = f"{MOLMIM_BASE_URL}/decode"
interpolated_hiddens_json = {
"hiddens": interpolated_hiddens.tolist(),
"mask": [[True] for _ in range(num_interpolations)]
}
response = requests.post(url, json=interpolated_hiddens_json, headers={"Content-Type": "application/json"})
response.raise_for_status()
decode_response = response.json()
generated_molecules = decode_response['generated']
print(f"✓ Decoded {len(generated_molecules)} molecules")
# Step 6: Deduplicate and create final molecule list
molecules = [smiles1_canon] + list(dict.fromkeys(generated_molecules)) + [smiles2_canon]
legends = ['Caffeine'] + [f'Interpolated #{i+1}' for i in range(len(molecules) - 2)] + ['Aspirin']
print(f"✓ Final molecule list: {len(molecules)} molecules (including endpoints)")
# Step 7: Create visualization
print("Step 4: Creating visualization...")
mols = [Chem.MolFromSmiles(smile, sanitize=False) for smile in molecules]
# Create the grid image
img = Draw.MolsToGridImage(
mols,
legends=legends,
molsPerRow=4,
subImgSize=(300, 300),
returnPNG=True
)
# Convert image to base64
img_buffer = io.BytesIO()
img.save(img_buffer, format='PNG')
img_buffer.seek(0)
img_base64 = base64.b64encode(img_buffer.getvalue()).decode('utf-8')
print("✓ Generated visualization image")
# Step 8: Save results
result = {
"molecules": molecules,
"legends": legends,
"interpolation_count": num_interpolations,
"image_base64": img_base64,
"input_molecules": {
"smiles1": smiles1_canon,
"smiles2": smiles2_canon
},
"note": "This test demonstrates the core functionality. MCP stdio transport returns native image content type."
}
# Save JSON result
with open("interpolation_result.json", "w") as f:
json.dump(result, f, indent=2)
# Save image
img.save("interpolation_visualization.png")
print("\n✓ Test completed successfully!")
print("✓ Results saved to:")
print(" - interpolation_result.json")
print(" - interpolation_visualization.png")
# Display some sample molecules
print(f"\nSample interpolated molecules:")
for i, (mol, legend) in enumerate(zip(molecules[1:-1], legends[1:-1])):
if i < 3: # Show first 3 interpolated molecules
print(f" {legend}: {mol}")
return True
except Exception as e:
print(f"✗ Error during interpolation test: {str(e)}")
return False
def test_mcp_interpolation_tool():
"""Test the MCP interpolation tool via direct API call"""
print("\n" + "="*60)
print("Testing MCP Interpolation Tool")
print("="*60)
# This would test the actual MCP tool call
# For now, we'll just show the expected format
print("MCP Tool Call Format:")
print(json.dumps({
"name": "molmim_interpolate",
"arguments": {
"smiles1": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
"smiles2": "CC(=O)OC1=CC=CC=C1C(=O)O",
"num_interpolations": 10,
"mols_per_row": 4,
"image_size": 300
}
}, indent=2))
if __name__ == "__main__":
print("MolMIM Molecular Interpolation Test")
print("="*40)
# Test the core interpolation functionality
success = test_molecular_interpolation()
if success:
# Test MCP tool format
test_mcp_interpolation_tool()
print("\n" + "="*60)
print("All tests completed!")
print("="*60)
else:
print("\n" + "="*60)
print("Tests failed!")
print("="*60)
sys.exit(1)