We provide all the information about MCP servers via our MCP API.
curl -X GET 'https://glama.ai/api/mcp/v1/servers/k-yenko/rowan-mcp'
If you have feedback or need assistance with the MCP directory API, please join our Discord server
"""
Molecule name to SMILES converter using Chemical Identifier Resolver (CIR).
Enables natural language molecule input for Rowan workflows.
"""
from typing import List, Dict, Annotated
from urllib.request import urlopen
from urllib.parse import quote
import logging
logger = logging.getLogger(__name__)
def molecule_lookup(
molecule_name: Annotated[str, "Common name, IUPAC name, or CAS number of molecule (e.g., 'aspirin', 'caffeine', '50-78-2')"],
fallback_to_input: Annotated[bool, "If lookup fails, return the input string assuming it might be SMILES"] = False
) -> str:
"""Convert molecule names to SMILES using Chemical Identifier Resolver (CIR).
Args:
molecule_name: Common name, IUPAC name, or CAS number of molecule (e.g., 'aspirin', 'caffeine', '50-78-2')
fallback_to_input: If lookup fails, return the input string assuming it might be SMILES
This tool enables natural language input for molecules by converting common names,
IUPAC names, CAS numbers, and other identifiers to SMILES strings that can be
used with Rowan workflows.
Supported Input Types:
- Common names: 'aspirin', 'caffeine', 'benzene', 'glucose'
- IUPAC names: '2-acetoxybenzoic acid', '1,3,7-trimethylpurine-2,6-dione'
- CAS numbers: '50-78-2' (aspirin), '58-08-2' (caffeine)
- InChI strings
- Already valid SMILES (will be validated)
Returns:
SMILES string if successful, error message if not found
Examples:
# Common drug name
result = molecule_lookup("aspirin")
# Returns: "CC(=O)Oc1ccccc1C(=O)O"
# IUPAC name
result = molecule_lookup("2-acetoxybenzoic acid")
# Returns: "CC(=O)Oc1ccccc1C(=O)O"
# CAS number
result = molecule_lookup("50-78-2")
# Returns: "CC(=O)Oc1ccccc1C(=O)O"
# Complex molecule
result = molecule_lookup("paracetamol")
# Returns: "CC(=O)Nc1ccc(O)cc1"
"""
try:
# Clean input
molecule_name = molecule_name.strip()
# Check if already SMILES-like (contains typical SMILES characters)
smiles_chars = {'=', '#', '(', ')', '[', ']', '@', '+', '-'}
if any(char in molecule_name for char in smiles_chars):
logger.info(f"Input '{molecule_name}' appears to be SMILES, returning as-is")
return molecule_name
# Query CIR service
logger.info(f"Looking up molecule: {molecule_name}")
url = f'http://cactus.nci.nih.gov/chemical/structure/{quote(molecule_name)}/smiles'
response = urlopen(url, timeout=10)
smiles = response.read().decode('utf8').strip()
# CIR may return multiple SMILES for some queries, take the first one
if '\n' in smiles:
smiles = smiles.split('\n')[0]
logger.info(f"Successfully converted '{molecule_name}' to SMILES: {smiles}")
return smiles
except Exception as e:
logger.warning(f"Failed to lookup '{molecule_name}': {e}")
if fallback_to_input:
logger.info(f"Returning original input as fallback: {molecule_name}")
return molecule_name
else:
return f"Could not find SMILES for '{molecule_name}'. Please check the name or provide a valid SMILES string."
def batch_molecule_lookup(
molecule_names: Annotated[List[str], "List of molecule names to convert to SMILES"],
skip_failures: Annotated[bool, "Skip molecules that fail lookup instead of stopping"] = True
) -> Dict[str, str]:
"""Convert multiple molecule names to SMILES in batch.
Args:
molecule_names: List of molecule names to convert to SMILES
skip_failures: Skip molecules that fail lookup instead of stopping
Useful for preparing multiple molecules for workflows or screening.
Returns:
Dictionary mapping input names to SMILES strings (or error messages)
Examples:
# Drug screening set
result = batch_molecule_lookup([
"aspirin",
"ibuprofen",
"paracetamol",
"caffeine"
])
# Returns: {
# "aspirin": "CC(=O)Oc1ccccc1C(=O)O",
# "ibuprofen": "CC(C)Cc1ccc(C(C)C(=O)O)cc1",
# "paracetamol": "CC(=O)Nc1ccc(O)cc1",
# "caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C"
# }
# Mixed input types
result = batch_molecule_lookup([
"benzene", # Common name
"50-78-2", # CAS number
"ethanoic acid" # IUPAC name
])
"""
results = {}
for name in molecule_names:
try:
smiles = molecule_lookup(name, fallback_to_input=False)
results[name] = smiles
except Exception as e:
error_msg = f"Lookup failed: {str(e)}"
if skip_failures:
logger.warning(f"Skipping {name}: {error_msg}")
results[name] = error_msg
else:
raise ValueError(f"Failed to lookup '{name}': {error_msg}")
return results
def validate_smiles(
smiles: Annotated[str, "SMILES string to validate"]
) -> Dict[str, any]:
"""Validate a SMILES string and return basic molecular properties.
Args:
smiles: SMILES string to validate
Uses RDKit to validate SMILES and extract basic properties.
Returns:
Dictionary with validation status and properties if valid
Examples:
result = validate_smiles("CC(=O)O")
# Returns: {
# "valid": True,
# "canonical_smiles": "CC(=O)O",
# "molecular_formula": "C2H4O2",
# "molecular_weight": 60.05
# }
"""
try:
from rdkit import Chem
from rdkit.Chem import Descriptors
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return {
"valid": False,
"error": "Invalid SMILES string"
}
return {
"valid": True,
"canonical_smiles": Chem.MolToSmiles(mol),
"molecular_formula": Chem.rdMolDescriptors.CalcMolFormula(mol),
"molecular_weight": round(Descriptors.MolWt(mol), 2),
"num_atoms": mol.GetNumAtoms(),
"num_bonds": mol.GetNumBonds()
}
except ImportError:
return {
"valid": "unknown",
"error": "RDKit not available for validation"
}
except Exception as e:
return {
"valid": False,
"error": str(e)
}
# Common molecules reference (for documentation)
COMMON_MOLECULES = {
# Drugs
"aspirin": "CC(=O)Oc1ccccc1C(=O)O",
"paracetamol": "CC(=O)Nc1ccc(O)cc1",
"acetaminophen": "CC(=O)Nc1ccc(O)cc1", # Same as paracetamol
"ibuprofen": "CC(C)Cc1ccc(C(C)C(=O)O)cc1",
"caffeine": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C",
"penicillin": "CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)O",
# Solvents
"water": "O",
"ethanol": "CCO",
"methanol": "CO",
"acetone": "CC(=O)C",
"dmso": "CS(=O)C",
"chloroform": "C(Cl)(Cl)Cl",
"benzene": "c1ccccc1",
"toluene": "Cc1ccccc1",
# Organic compounds
"glucose": "C(C1C(C(C(C(O1)O)O)O)O)O",
"acetic acid": "CC(=O)O",
"ethanoic acid": "CC(=O)O", # IUPAC for acetic acid
"phenol": "Oc1ccccc1",
"aniline": "Nc1ccccc1",
"naphthalene": "c1ccc2c(c1)cccc2",
# Amino acids
"glycine": "C(C(=O)O)N",
"alanine": "CC(C(=O)O)N",
"valine": "CC(C)C(C(=O)O)N",
"leucine": "CC(C)CC(C(=O)O)N",
"lysine": "C(CCN)CC(C(=O)O)N",
}